C14H13N3OS — CID 63618214
3-(3-benzyl-1,2,4-oxadiazol-5-yl)-5-methylthiophen-2-amine (PubChem CID 63618214) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is 3-(3-benzyl-1,2,4-oxadiazol-5-yl)-5-methylthiophen-2-amine.
| Compound Name | 3-(3-benzyl-1,2,4-oxadiazol-5-yl)-5-methylthiophen-2-amine |
|---|---|
| PubChem CID | 63618214 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-(3-benzyl-1,2,4-oxadiazol-5-yl)-5-methylthiophen-2-amine |
| SMILES | Cc1cc(-c2nc(Cc3ccccc3)no2)c(N)s1 |
| InChI | InChI=1S/C14H13N3OS/c1-9-7-11(13(15)19-9)14-16-12(17-18-14)8-10-5-3-2-4-6-10/h2-7H,8,15H2,1H3 |
| InChIKey | KNSSKOQPUYSJGM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |