C28H31F2N3O2Si — CID 171795472
5-[5-[2-[tert-butyl(diphenyl)silyl]oxy-3,3-difluoropropyl]-1,2,4-oxadiazol-3-yl]-2-methylaniline (PubChem CID 171795472) has the molecular formula C28H31F2N3O2Si and a molecular weight of 507.66 g/mol. Its IUPAC name is 5-[5-[2-[tert-butyl(diphenyl)silyl]oxy-3,3-difluoropropyl]-1,2,4-oxadiazol-3-yl]-2-methylaniline.
| Compound Name | 5-[5-[2-[tert-butyl(diphenyl)silyl]oxy-3,3-difluoropropyl]-1,2,4-oxadiazol-3-yl]-2-methylaniline |
|---|---|
| PubChem CID | 171795472 |
| Molecular Formula | C28H31F2N3O2Si |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 5-[5-[2-[tert-butyl(diphenyl)silyl]oxy-3,3-difluoropropyl]-1,2,4-oxadiazol-3-yl]-2-methylaniline |
| SMILES | Cc1ccc(-c2noc(CC(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C(F)F)n2)cc1N |
| InChI | InChI=1S/C28H31F2N3O2Si/c1-19-15-16-20(17-23(19)31)27-32-25(34-33-27)18-24(26(29)30)35-36(28(2,3)4,21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-17,24,26H,18,31H2,1-4H3 |
| InChIKey | HSBSUOSKPKEFMS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|