C18H16F3N3O2 — CID 19330506
2-methyl-3-[5-[3-(2,2,2-trifluoroethoxymethyl)phenyl]-1,2,4-oxadiazol-3-yl]aniline (PubChem CID 19330506) has the molecular formula C18H16F3N3O2 and a molecular weight of 363.34 g/mol. Its IUPAC name is 2-methyl-3-[5-[3-(2,2,2-trifluoroethoxymethyl)phenyl]-1,2,4-oxadiazol-3-yl]aniline.
| Compound Name | 2-methyl-3-[5-[3-(2,2,2-trifluoroethoxymethyl)phenyl]-1,2,4-oxadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 19330506 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2-methyl-3-[5-[3-(2,2,2-trifluoroethoxymethyl)phenyl]-1,2,4-oxadiazol-3-yl]aniline |
| SMILES | Cc1c(N)cccc1-c1noc(-c2cccc(COCC(F)(F)F)c2)n1 |
| InChI | InChI=1S/C18H16F3N3O2/c1-11-14(6-3-7-15(11)22)16-23-17(26-24-16)13-5-2-4-12(8-13)9-25-10-18(19,20)21/h2-8H,9-10,22H2,1H3 |
| InChIKey | QSHJFMLEPBKULH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|