C19H24N2O — CID 144545542
5-ethyl-3-methyl-6-(2-piperidin-1-ylphenyl)-1H-pyridin-2-one (PubChem CID 144545542) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 5-ethyl-3-methyl-6-(2-piperidin-1-ylphenyl)-1H-pyridin-2-one.
| Compound Name | 5-ethyl-3-methyl-6-(2-piperidin-1-ylphenyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 144545542 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 5-ethyl-3-methyl-6-(2-piperidin-1-ylphenyl)-1H-pyridin-2-one |
| SMILES | CCc1cc(C)c(=O)[nH]c1-c1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C19H24N2O/c1-3-15-13-14(2)19(22)20-18(15)16-9-5-6-10-17(16)21-11-7-4-8-12-21/h5-6,9-10,13H,3-4,7-8,11-12H2,1-2H3,(H,20,22) |
| InChIKey | LBKQHSFGANUBDR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |