C17H21NO2S2 — CID 145379219
1-[2-[(5-methylthiophen-2-yl)sulfonylmethyl]phenyl]piperidine (PubChem CID 145379219) has the molecular formula C17H21NO2S2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 1-[2-[(5-methylthiophen-2-yl)sulfonylmethyl]phenyl]piperidine.
| Compound Name | 1-[2-[(5-methylthiophen-2-yl)sulfonylmethyl]phenyl]piperidine |
|---|---|
| PubChem CID | 145379219 |
| Molecular Formula | C17H21NO2S2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-[2-[(5-methylthiophen-2-yl)sulfonylmethyl]phenyl]piperidine |
| SMILES | Cc1ccc(S(=O)(=O)Cc2ccccc2N2CCCCC2)s1 |
| InChI | InChI=1S/C17H21NO2S2/c1-14-9-10-17(21-14)22(19,20)13-15-7-3-4-8-16(15)18-11-5-2-6-12-18/h3-4,7-10H,2,5-6,11-13H2,1H3 |
| InChIKey | OVYATCCUHIBRFL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |