C24H38N4O4S — CID 144546070
N-[3-[2-[3-[2-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]sulfanylamino]ethylamino]propoxy]ethoxy]propyl]acetamide (PubChem CID 144546070) has the molecular formula C24H38N4O4S and a molecular weight of 478.66 g/mol. Its IUPAC name is N-[3-[2-[3-[2-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]sulfanylamino]ethylamino]propoxy]ethoxy]propyl]acetamide.
| Compound Name | N-[3-[2-[3-[2-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]sulfanylamino]ethylamino]propoxy]ethoxy]propyl]acetamide |
|---|---|
| PubChem CID | 144546070 |
| Molecular Formula | C24H38N4O4S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | N-[3-[2-[3-[2-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]sulfanylamino]ethylamino]propoxy]ethoxy]propyl]acetamide |
| SMILES | CC(=O)NCCCOCCOCCCNCCNSc1cc(-c2c(C)noc2C)ccc1C |
| InChI | InChI=1S/C24H38N4O4S/c1-18-7-8-22(24-19(2)28-32-20(24)3)17-23(18)33-27-12-11-25-9-5-13-30-15-16-31-14-6-10-26-21(4)29/h7-8,17,25,27H,5-6,9-16H2,1-4H3,(H,26,29) |
| InChIKey | HTCSOJGPTVOVSE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|