C14H26N2O — CID 144547117
4-(ethenoxymethyl)-4-methylpiperidine;2-methylidenebut-3-en-1-amine (PubChem CID 144547117) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 4-(ethenoxymethyl)-4-methylpiperidine;2-methylidenebut-3-en-1-amine.
| Compound Name | 4-(ethenoxymethyl)-4-methylpiperidine;2-methylidenebut-3-en-1-amine |
|---|---|
| PubChem CID | 144547117 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 4-(ethenoxymethyl)-4-methylpiperidine;2-methylidenebut-3-en-1-amine |
| SMILES | C=CC(=C)CN.C=COCC1(C)CCNCC1 |
| InChI | InChI=1S/C9H17NO.C5H9N/c1-3-11-8-9(2)4-6-10-7-5-9;1-3-5(2)4-6/h3,10H,1,4-8H2,2H3;3H,1-2,4,6H2 |
| InChIKey | SEZBJHQUSMRTEF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|