About 4-(ethenoxymethyl)-4-ethenylpiperidine;prop-2-en-1-amine
4-(ethenoxymethyl)-4-ethenylpiperidine;prop-2-en-1-amine (PubChem CID 144547629) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is 4-(ethenoxymethyl)-4-ethenylpiperidine;prop-2-en-1-amine.
Molecular Properties
| Compound Name | 4-(ethenoxymethyl)-4-ethenylpiperidine;prop-2-en-1-amine |
| PubChem CID | 144547629 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 4-(ethenoxymethyl)-4-ethenylpiperidine;prop-2-en-1-amine |
| SMILES | C=CCN.C=COCC1(C=C)CCNCC1 |
| InChI | InChI=1S/C10H17NO.C3H7N/c1-3-10(9-12-4-2)5-7-11-8-6-10;1-2-3-4/h3-4,11H,1-2,5-9H2;2H,1,3-4H2 |
| InChIKey | KVICQDYWDBDPNZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethenoxymethyl)-4-ethenylpiperidine;prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethenoxymethyl)-4-ethenylpiperidine;prop-2-en-1-amine?
The IUPAC name of 4-(ethenoxymethyl)-4-ethenylpiperidine;prop-2-en-1-amine (CID 144547629) is 4-(ethenoxymethyl)-4-ethenylpiperidine;prop-2-en-1-amine.
What is the SMILES notation for 4-(ethenoxymethyl)-4-ethenylpiperidine;prop-2-en-1-amine?
The canonical SMILES for 4-(ethenoxymethyl)-4-ethenylpiperidine;prop-2-en-1-amine is C=CCN.C=COCC1(C=C)CCNCC1.
What is the InChIKey of 4-(ethenoxymethyl)-4-ethenylpiperidine;prop-2-en-1-amine?
The InChIKey is KVICQDYWDBDPNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO.C3H7N/c1-3-10(9-12-4-2)5-7-11-8-6-10;1-2-3-4/h3-4,11H,1-2,5-9H2;2H,1,3-4H2.
What are the key properties of 4-(ethenoxymethyl)-4-ethenylpiperidine;prop-2-en-1-amine?
4-(ethenoxymethyl)-4-ethenylpiperidine;prop-2-en-1-amine has a molecular weight of 224.35 g/mol, XLogP of 1.83, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethenoxymethyl)-4-ethenylpiperidine;prop-2-en-1-amine is sourced from PubChem (CID 144547629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).