C15H31NO — CID 144547153
ethane;ethene;1-(2-methoxycyclohexa-1,5-dien-1-yl)-N-methylmethanamine (PubChem CID 144547153) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is ethane;ethene;1-(2-methoxycyclohexa-1,5-dien-1-yl)-N-methylmethanamine.
| Compound Name | ethane;ethene;1-(2-methoxycyclohexa-1,5-dien-1-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 144547153 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | ethane;ethene;1-(2-methoxycyclohexa-1,5-dien-1-yl)-N-methylmethanamine |
| SMILES | C=C.CC.CC.CNCC1=C(OC)CCC=C1 |
| InChI | InChI=1S/C9H15NO.2C2H6.C2H4/c1-10-7-8-5-3-4-6-9(8)11-2;3*1-2/h3,5,10H,4,6-7H2,1-2H3;2*1-2H3;1-2H2 |
| InChIKey | AFDMOUZONRDITR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|