About (Z)-but-2-ene;2-methoxy-N-methylbenzamide
(Z)-but-2-ene;2-methoxy-N-methylbenzamide (PubChem CID 144547446) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is (Z)-but-2-ene;2-methoxy-N-methylbenzamide.
Molecular Properties
| Compound Name | (Z)-but-2-ene;2-methoxy-N-methylbenzamide |
| PubChem CID | 144547446 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (Z)-but-2-ene;2-methoxy-N-methylbenzamide |
| SMILES | C/C=C\C.CNC(=O)c1ccccc1OC |
| InChI | InChI=1S/C9H11NO2.C4H8/c1-10-9(11)7-5-3-4-6-8(7)12-2;1-3-4-2/h3-6H,1-2H3,(H,10,11);3-4H,1-2H3/b;4-3- |
| InChIKey | ULBKDQBGIFUTJK-QGAMPUOQSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;2-methoxy-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;2-methoxy-N-methylbenzamide?
The IUPAC name of (Z)-but-2-ene;2-methoxy-N-methylbenzamide (CID 144547446) is (Z)-but-2-ene;2-methoxy-N-methylbenzamide.
What is the SMILES notation for (Z)-but-2-ene;2-methoxy-N-methylbenzamide?
The canonical SMILES for (Z)-but-2-ene;2-methoxy-N-methylbenzamide is C/C=C\C.CNC(=O)c1ccccc1OC.
What is the InChIKey of (Z)-but-2-ene;2-methoxy-N-methylbenzamide?
The InChIKey is ULBKDQBGIFUTJK-QGAMPUOQSA-N. The full InChI is InChI=1S/C9H11NO2.C4H8/c1-10-9(11)7-5-3-4-6-8(7)12-2;1-3-4-2/h3-6H,1-2H3,(H,10,11);3-4H,1-2H3/b;4-3-.
What are the key properties of (Z)-but-2-ene;2-methoxy-N-methylbenzamide?
(Z)-but-2-ene;2-methoxy-N-methylbenzamide has a molecular weight of 221.30 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;2-methoxy-N-methylbenzamide is sourced from PubChem (CID 144547446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).