C24H36N2O2 — CID 144547562
ethane;3-(4-hydroxyphenyl)-N-[3-[3-(methylaminomethyl)phenyl]pentyl]propanamide (PubChem CID 144547562) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is ethane;3-(4-hydroxyphenyl)-N-[3-[3-(methylaminomethyl)phenyl]pentyl]propanamide.
| Compound Name | ethane;3-(4-hydroxyphenyl)-N-[3-[3-(methylaminomethyl)phenyl]pentyl]propanamide |
|---|---|
| PubChem CID | 144547562 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | ethane;3-(4-hydroxyphenyl)-N-[3-[3-(methylaminomethyl)phenyl]pentyl]propanamide |
| SMILES | CC.CCC(CCNC(=O)CCc1ccc(O)cc1)c1cccc(CNC)c1 |
| InChI | InChI=1S/C22H30N2O2.C2H6/c1-3-19(20-6-4-5-18(15-20)16-23-2)13-14-24-22(26)12-9-17-7-10-21(25)11-8-17;1-2/h4-8,10-11,15,19,23,25H,3,9,12-14,16H2,1-2H3,(H,24,26);1-2H3 |
| InChIKey | VCLZJPREYHGDFX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |