C29H47NO2 — CID 144853439
ethane;4-(4-hydroxyphenyl)butan-2-one;N-methyl-1-(3-nonan-4-ylphenyl)methanamine (PubChem CID 144853439) has the molecular formula C29H47NO2 and a molecular weight of 441.70 g/mol. Its IUPAC name is ethane;4-(4-hydroxyphenyl)butan-2-one;N-methyl-1-(3-nonan-4-ylphenyl)methanamine.
| Compound Name | ethane;4-(4-hydroxyphenyl)butan-2-one;N-methyl-1-(3-nonan-4-ylphenyl)methanamine |
|---|---|
| PubChem CID | 144853439 |
| Molecular Formula | C29H47NO2 |
| Molecular Weight | 441.70 g/mol |
| Exact Mass | 441.36 |
| IUPAC Name | ethane;4-(4-hydroxyphenyl)butan-2-one;N-methyl-1-(3-nonan-4-ylphenyl)methanamine |
| SMILES | CC.CC(=O)CCc1ccc(O)cc1.CCCCCC(CCC)c1cccc(CNC)c1 |
| InChI | InChI=1S/C17H29N.C10H12O2.C2H6/c1-4-6-7-11-16(9-5-2)17-12-8-10-15(13-17)14-18-3;1-8(11)2-3-9-4-6-10(12)7-5-9;1-2/h8,10,12-13,16,18H,4-7,9,11,14H2,1-3H3;4-7,12H,2-3H2,1H3;1-2H3 |
| InChIKey | CYHGVJHKNQYBJS-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.70 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|