C31H27FN4O3S — CID 144548364
6-[but-3-enyl(sulfanyl)amino]-5-(15-fluoro-8-oxa-3,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,11(16),12,14-heptaen-4-yl)-N-methyl-2-prop-1-en-2-yl-1-benzofuran-3-carboxamide (PubChem CID 144548364) has the molecular formula C31H27FN4O3S and a molecular weight of 554.65 g/mol. Its IUPAC name is 6-[but-3-enyl(sulfanyl)amino]-5-(15-fluoro-8-oxa-3,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,11(16),12,14-heptaen-4-yl)-N-methyl-2-prop-1-en-2-yl-1-benzofuran-3-carboxamide.
| Compound Name | 6-[but-3-enyl(sulfanyl)amino]-5-(15-fluoro-8-oxa-3,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,11(16),12,14-heptaen-4-yl)-N-methyl-2-prop-1-en-2-yl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 144548364 |
| Molecular Formula | C31H27FN4O3S |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 6-[but-3-enyl(sulfanyl)amino]-5-(15-fluoro-8-oxa-3,10-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2(7),3,5,11(16),12,14-heptaen-4-yl)-N-methyl-2-prop-1-en-2-yl-1-benzofuran-3-carboxamide |
| SMILES | C=CCCN(S)c1cc2oc(C(=C)C)c(C(=O)NC)c2cc1-c1ccc2c(n1)-c1cc3c(F)cccc3n1CO2 |
| InChI | InChI=1S/C31H27FN4O3S/c1-5-6-12-36(40)24-15-27-20(28(31(37)33-4)30(39-27)17(2)3)13-19(24)22-10-11-26-29(34-22)25-14-18-21(32)8-7-9-23(18)35(25)16-38-26/h5,7-11,13-15,40H,1-2,6,12,16H2,3-4H3,(H,33,37) |
| InChIKey | AJMVDFGSCVZPIW-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|