C17H14Br2ClFN2O — CID 144548383
6-chloro-2-(4-fluoro-1H-indol-2-yl)pyridin-3-ol;(E)-1,1-dibromobut-2-ene (PubChem CID 144548383) has the molecular formula C17H14Br2ClFN2O and a molecular weight of 476.57 g/mol. Its IUPAC name is 6-chloro-2-(4-fluoro-1H-indol-2-yl)pyridin-3-ol;(E)-1,1-dibromobut-2-ene.
| Compound Name | 6-chloro-2-(4-fluoro-1H-indol-2-yl)pyridin-3-ol;(E)-1,1-dibromobut-2-ene |
|---|---|
| PubChem CID | 144548383 |
| Molecular Formula | C17H14Br2ClFN2O |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 473.91 |
| IUPAC Name | 6-chloro-2-(4-fluoro-1H-indol-2-yl)pyridin-3-ol;(E)-1,1-dibromobut-2-ene |
| SMILES | C/C=C/C(Br)Br.Oc1ccc(Cl)nc1-c1cc2c(F)cccc2[nH]1 |
| InChI | InChI=1S/C13H8ClFN2O.C4H6Br2/c14-12-5-4-11(18)13(17-12)10-6-7-8(15)2-1-3-9(7)16-10;1-2-3-4(5)6/h1-6,16,18H;2-4H,1H3/b;3-2+ |
| InChIKey | TZXHYALBWIVJRR-ZPYUXNTASA-N |
| XLogP | 6.41 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|