C17H17FN2O3 — CID 144549739
N-[(E)-3-[6-(4-fluoro-3-methoxyphenoxy)-3-pyridinyl]prop-2-enyl]acetamide (PubChem CID 144549739) has the molecular formula C17H17FN2O3 and a molecular weight of 316.33 g/mol. Its IUPAC name is N-[(E)-3-[6-(4-fluoro-3-methoxyphenoxy)-3-pyridinyl]prop-2-enyl]acetamide.
| Compound Name | N-[(E)-3-[6-(4-fluoro-3-methoxyphenoxy)-3-pyridinyl]prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 144549739 |
| Molecular Formula | C17H17FN2O3 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[(E)-3-[6-(4-fluoro-3-methoxyphenoxy)-3-pyridinyl]prop-2-enyl]acetamide |
| SMILES | COc1cc(Oc2ccc(/C=C/CNC(C)=O)cn2)ccc1F |
| InChI | InChI=1S/C17H17FN2O3/c1-12(21)19-9-3-4-13-5-8-17(20-11-13)23-14-6-7-15(18)16(10-14)22-2/h3-8,10-11H,9H2,1-2H3,(H,19,21)/b4-3+ |
| InChIKey | YUJWMYUJLWKPMU-ONEGZZNKSA-N |
| XLogP | 3.17 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |