C20H22Cl2N2O2 — CID 144549677
acetylene;N-[(E)-3-[6-(2,4-dichlorophenoxy)-3-pyridinyl]prop-2-enyl]acetamide;ethane (PubChem CID 144549677) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is acetylene;N-[(E)-3-[6-(2,4-dichlorophenoxy)-3-pyridinyl]prop-2-enyl]acetamide;ethane.
| Compound Name | acetylene;N-[(E)-3-[6-(2,4-dichlorophenoxy)-3-pyridinyl]prop-2-enyl]acetamide;ethane |
|---|---|
| PubChem CID | 144549677 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | acetylene;N-[(E)-3-[6-(2,4-dichlorophenoxy)-3-pyridinyl]prop-2-enyl]acetamide;ethane |
| SMILES | C#C.CC.CC(=O)NC/C=C/c1ccc(Oc2ccc(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C16H14Cl2N2O2.C2H6.C2H2/c1-11(21)19-8-2-3-12-4-7-16(20-10-12)22-15-6-5-13(17)9-14(15)18;2*1-2/h2-7,9-10H,8H2,1H3,(H,19,21);1-2H3;1-2H/b3-2+;; |
| InChIKey | FBMPAEOLXPVACE-WTVBWJGASA-N |
| XLogP | 5.61 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|