C20H19FN2O3 — CID 144549854
N-[(E,3R)-1-[6-(3-ethoxy-5-fluorophenoxy)-3-pyridinyl]pent-1-en-4-yn-3-yl]acetamide (PubChem CID 144549854) has the molecular formula C20H19FN2O3 and a molecular weight of 354.38 g/mol. Its IUPAC name is N-[(E,3R)-1-[6-(3-ethoxy-5-fluorophenoxy)-3-pyridinyl]pent-1-en-4-yn-3-yl]acetamide.
| Compound Name | N-[(E,3R)-1-[6-(3-ethoxy-5-fluorophenoxy)-3-pyridinyl]pent-1-en-4-yn-3-yl]acetamide |
|---|---|
| PubChem CID | 144549854 |
| Molecular Formula | C20H19FN2O3 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-[(E,3R)-1-[6-(3-ethoxy-5-fluorophenoxy)-3-pyridinyl]pent-1-en-4-yn-3-yl]acetamide |
| SMILES | C#C[C@@H](/C=C/c1ccc(Oc2cc(F)cc(OCC)c2)nc1)NC(C)=O |
| InChI | InChI=1S/C20H19FN2O3/c1-4-17(23-14(3)24)8-6-15-7-9-20(22-13-15)26-19-11-16(21)10-18(12-19)25-5-2/h1,6-13,17H,5H2,2-3H3,(H,23,24)/b8-6+/t17-/m0/s1 |
| InChIKey | HBMDSFQIQQXDPB-JKNJVXJCSA-N |
| XLogP | 3.56 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|