C16H19N3O2 — CID 144549920
ethane;2-[(E)-3-(1H-pyrazol-4-yl)prop-2-enyl]-4,5-dihydroisoindole-1,3-dione (PubChem CID 144549920) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is ethane;2-[(E)-3-(1H-pyrazol-4-yl)prop-2-enyl]-4,5-dihydroisoindole-1,3-dione.
| Compound Name | ethane;2-[(E)-3-(1H-pyrazol-4-yl)prop-2-enyl]-4,5-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 144549920 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | ethane;2-[(E)-3-(1H-pyrazol-4-yl)prop-2-enyl]-4,5-dihydroisoindole-1,3-dione |
| SMILES | CC.O=C1C2=C(CCC=C2)C(=O)N1C/C=C/c1cn[nH]c1 |
| InChI | InChI=1S/C14H13N3O2.C2H6/c18-13-11-5-1-2-6-12(11)14(19)17(13)7-3-4-10-8-15-16-9-10;1-2/h1,3-5,8-9H,2,6-7H2,(H,15,16);1-2H3/b4-3+; |
| InChIKey | GDFUAZVXMDZYEJ-BJILWQEISA-N |
| XLogP | 2.46 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|