C17H26N4O — CID 155748528
N-ethyl-3-methyl-2-propan-2-yl-N-[(Z)-[(E)-2-(1H-pyrazol-4-yl)but-2-enylidene]amino]but-2-enamide (PubChem CID 155748528) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is N-ethyl-3-methyl-2-propan-2-yl-N-[(Z)-[(E)-2-(1H-pyrazol-4-yl)but-2-enylidene]amino]but-2-enamide.
| Compound Name | N-ethyl-3-methyl-2-propan-2-yl-N-[(Z)-[(E)-2-(1H-pyrazol-4-yl)but-2-enylidene]amino]but-2-enamide |
|---|---|
| PubChem CID | 155748528 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | N-ethyl-3-methyl-2-propan-2-yl-N-[(Z)-[(E)-2-(1H-pyrazol-4-yl)but-2-enylidene]amino]but-2-enamide |
| SMILES | C/C=C(/C=N\N(CC)C(=O)C(=C(C)C)C(C)C)c1cn[nH]c1 |
| InChI | InChI=1S/C17H26N4O/c1-7-14(15-9-18-19-10-15)11-20-21(8-2)17(22)16(12(3)4)13(5)6/h7,9-12H,8H2,1-6H3,(H,18,19)/b14-7-,20-11- |
| InChIKey | ZAMOHLKKBANXDF-JMQLGKLYSA-N |
| XLogP | 3.64 |
| TPSA | 61.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|