C14H13BrO3S2 — CID 144550226
methyl 2-[2-[5-bromo-3-(2-oxopropyl)thiophen-2-yl]thiophen-3-yl]acetate (PubChem CID 144550226) has the molecular formula C14H13BrO3S2 and a molecular weight of 373.29 g/mol. Its IUPAC name is methyl 2-[2-[5-bromo-3-(2-oxopropyl)thiophen-2-yl]thiophen-3-yl]acetate.
| Compound Name | methyl 2-[2-[5-bromo-3-(2-oxopropyl)thiophen-2-yl]thiophen-3-yl]acetate |
|---|---|
| PubChem CID | 144550226 |
| Molecular Formula | C14H13BrO3S2 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | methyl 2-[2-[5-bromo-3-(2-oxopropyl)thiophen-2-yl]thiophen-3-yl]acetate |
| SMILES | COC(=O)Cc1ccsc1-c1sc(Br)cc1CC(C)=O |
| InChI | InChI=1S/C14H13BrO3S2/c1-8(16)5-10-6-11(15)20-14(10)13-9(3-4-19-13)7-12(17)18-2/h3-4,6H,5,7H2,1-2H3 |
| InChIKey | VUBYPURVXUXEDE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |