C26H38O3S2 — CID 142714703
methyl 5-[4-hexyl-5-(3-hexylthiophen-2-yl)thiophen-2-yl]-5-oxopentanoate (PubChem CID 142714703) has the molecular formula C26H38O3S2 and a molecular weight of 462.72 g/mol. Its IUPAC name is methyl 5-[4-hexyl-5-(3-hexylthiophen-2-yl)thiophen-2-yl]-5-oxopentanoate.
| Compound Name | methyl 5-[4-hexyl-5-(3-hexylthiophen-2-yl)thiophen-2-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 142714703 |
| Molecular Formula | C26H38O3S2 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | methyl 5-[4-hexyl-5-(3-hexylthiophen-2-yl)thiophen-2-yl]-5-oxopentanoate |
| SMILES | CCCCCCc1ccsc1-c1sc(C(=O)CCCC(=O)OC)cc1CCCCCC |
| InChI | InChI=1S/C26H38O3S2/c1-4-6-8-10-13-20-17-18-30-25(20)26-21(14-11-9-7-5-2)19-23(31-26)22(27)15-12-16-24(28)29-3/h17-19H,4-16H2,1-3H3 |
| InChIKey | LTBFNGKGBDTXNM-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|