C35H56O6 — CID 144550618
[(1S)-2-hydroxy-2-methyl-1-[(1S,4S,5R,16R,18S,21R)-4,17,17-trimethyl-18-(oxan-2-yloxy)-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]propyl] acetate (PubChem CID 144550618) has the molecular formula C35H56O6 and a molecular weight of 572.83 g/mol. Its IUPAC name is [(1S)-2-hydroxy-2-methyl-1-[(1S,4S,5R,16R,18S,21R)-4,17,17-trimethyl-18-(oxan-2-yloxy)-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]propyl] acetate.
| Compound Name | [(1S)-2-hydroxy-2-methyl-1-[(1S,4S,5R,16R,18S,21R)-4,17,17-trimethyl-18-(oxan-2-yloxy)-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]propyl] acetate |
|---|---|
| PubChem CID | 144550618 |
| Molecular Formula | C35H56O6 |
| Molecular Weight | 572.83 g/mol |
| Exact Mass | 572.41 |
| IUPAC Name | [(1S)-2-hydroxy-2-methyl-1-[(1S,4S,5R,16R,18S,21R)-4,17,17-trimethyl-18-(oxan-2-yloxy)-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]propyl] acetate |
| SMILES | CC(=O)O[C@@H](C1CC[C@H]2C(CC3C4CC[C@H]5C(C)(C)[C@@H](OC6CCCCO6)CC[C@@]56C[C@@]46CC[C@@]32C)O1)C(C)(C)O |
| InChI | InChI=1S/C35H56O6/c1-21(36)39-30(32(4,5)37)25-12-10-23-26(40-25)19-24-22-11-13-27-31(2,3)28(41-29-9-7-8-18-38-29)14-15-35(27)20-34(22,35)17-16-33(23,24)6/h22-30,37H,7-20H2,1-6H3/t22?,23-,24?,25?,26?,27-,28-,29?,30-,33+,34-,35+/m0/s1 |
| InChIKey | IHNYJOLMPWGIJO-FRYPRUBRSA-N |
| XLogP | 6.81 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.83 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|