C35H56O7 — CID 144550594
[(1S)-2-hydroxy-2-methyl-1-[(4R,18S,21R)-4,17,17-trimethyl-18-(oxan-2-yloxy)-11-oxo-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]propyl] acetate;molecular hydrogen (PubChem CID 144550594) has the molecular formula C35H56O7 and a molecular weight of 588.83 g/mol. Its IUPAC name is [(1S)-2-hydroxy-2-methyl-1-[(4R,18S,21R)-4,17,17-trimethyl-18-(oxan-2-yloxy)-11-oxo-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]propyl] acetate;molecular hydrogen.
| Compound Name | [(1S)-2-hydroxy-2-methyl-1-[(4R,18S,21R)-4,17,17-trimethyl-18-(oxan-2-yloxy)-11-oxo-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]propyl] acetate;molecular hydrogen |
|---|---|
| PubChem CID | 144550594 |
| Molecular Formula | C35H56O7 |
| Molecular Weight | 588.83 g/mol |
| Exact Mass | 588.40 |
| IUPAC Name | [(1S)-2-hydroxy-2-methyl-1-[(4R,18S,21R)-4,17,17-trimethyl-18-(oxan-2-yloxy)-11-oxo-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]propyl] acetate;molecular hydrogen |
| SMILES | CC(=O)O[C@@H](C1CCC2C(O1)C(=O)C1C3CCC4C(C)(C)[C@@H](OC5CCCCO5)CC[C@@]45CC35CC[C@]21C)C(C)(C)O.[H][H] |
| InChI | InChI=1S/C35H54O7.H2/c1-20(36)40-30(32(4,5)38)23-12-10-22-29(41-23)28(37)27-21-11-13-24-31(2,3)25(42-26-9-7-8-18-39-26)14-15-35(24)19-34(21,35)17-16-33(22,27)6;/h21-27,29-30,38H,7-19H2,1-6H3;1H/t21?,22?,23?,24?,25-,26?,27?,29?,30-,33+,34?,35+;/m0./s1 |
| InChIKey | XSRTZXIDCKFDOX-CQZKRHCGSA-N |
| XLogP | 6.23 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.83 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|