C37H58O9 — CID 144551041
[1-[(12S,16R,22R)-18-(4,5-dihydroxyoxan-2-yl)oxy-4,12,17,17,22-pentamethyl-11-oxo-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]-2-hydroxy-2-methylpropyl] acetate (PubChem CID 144551041) has the molecular formula C37H58O9 and a molecular weight of 646.86 g/mol. Its IUPAC name is [1-[(12S,16R,22R)-18-(4,5-dihydroxyoxan-2-yl)oxy-4,12,17,17,22-pentamethyl-11-oxo-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]-2-hydroxy-2-methylpropyl] acetate.
| Compound Name | [1-[(12S,16R,22R)-18-(4,5-dihydroxyoxan-2-yl)oxy-4,12,17,17,22-pentamethyl-11-oxo-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]-2-hydroxy-2-methylpropyl] acetate |
|---|---|
| PubChem CID | 144551041 |
| Molecular Formula | C37H58O9 |
| Molecular Weight | 646.86 g/mol |
| Exact Mass | 646.41 |
| IUPAC Name | [1-[(12S,16R,22R)-18-(4,5-dihydroxyoxan-2-yl)oxy-4,12,17,17,22-pentamethyl-11-oxo-9-oxahexacyclo[11.9.0.01,21.04,12.05,10.016,21]docosan-8-yl]-2-hydroxy-2-methylpropyl] acetate |
| SMILES | CC(=O)OC(C1CCC2C(O1)C(=O)[C@@]1(C)C3CC[C@H]4C(C)(C)C(OC5CC(O)C(O)CO5)CCC45[C@@H](C)C35CCC21C)C(C)(C)O |
| InChI | InChI=1S/C37H58O9/c1-19-36-14-13-27(46-28-17-22(39)23(40)18-43-28)32(3,4)25(36)11-12-26-35(8)30(41)29-21(34(35,7)15-16-37(19,26)36)9-10-24(45-29)31(33(5,6)42)44-20(2)38/h19,21-29,31,39-40,42H,9-18H2,1-8H3/t19-,21?,22?,23?,24?,25+,26?,27?,28?,29?,31?,34?,35-,36?,37?/m1/s1 |
| InChIKey | FJATVLJFQSSVMA-MZTAAZEUSA-N |
| XLogP | 4.56 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.86 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|