C30H49NO4 — CID 144551399
8-(1-ethoxy-2-hydroxy-2-methylpropyl)-4,17,17-trimethyl-9-oxa-18-azahexacyclo[11.10.0.01,22.04,12.05,10.016,22]tricosan-19-one (PubChem CID 144551399) has the molecular formula C30H49NO4 and a molecular weight of 487.73 g/mol. Its IUPAC name is 8-(1-ethoxy-2-hydroxy-2-methylpropyl)-4,17,17-trimethyl-9-oxa-18-azahexacyclo[11.10.0.01,22.04,12.05,10.016,22]tricosan-19-one.
| Compound Name | 8-(1-ethoxy-2-hydroxy-2-methylpropyl)-4,17,17-trimethyl-9-oxa-18-azahexacyclo[11.10.0.01,22.04,12.05,10.016,22]tricosan-19-one |
|---|---|
| PubChem CID | 144551399 |
| Molecular Formula | C30H49NO4 |
| Molecular Weight | 487.73 g/mol |
| Exact Mass | 487.37 |
| IUPAC Name | 8-(1-ethoxy-2-hydroxy-2-methylpropyl)-4,17,17-trimethyl-9-oxa-18-azahexacyclo[11.10.0.01,22.04,12.05,10.016,22]tricosan-19-one |
| SMILES | CCOC(C1CCC2C(CC3C4CCC5C(C)(C)NC(=O)CCC56CC46CCC23C)O1)C(C)(C)O |
| InChI | InChI=1S/C30H49NO4/c1-7-34-25(27(4,5)33)21-10-8-19-22(35-21)16-20-18-9-11-23-26(2,3)31-24(32)12-13-30(23)17-29(18,30)15-14-28(19,20)6/h18-23,25,33H,7-17H2,1-6H3,(H,31,32) |
| InChIKey | ZNPWZDIFGQZYDB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.73 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |