C13H22N2O2 — CID 144552538
[4-[(2Z)-2-[(E)-1-aminoprop-1-enyl]penta-2,4-dienyl]morpholin-3-yl]methanol (PubChem CID 144552538) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is [4-[(2Z)-2-[(E)-1-aminoprop-1-enyl]penta-2,4-dienyl]morpholin-3-yl]methanol.
| Compound Name | [4-[(2Z)-2-[(E)-1-aminoprop-1-enyl]penta-2,4-dienyl]morpholin-3-yl]methanol |
|---|---|
| PubChem CID | 144552538 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | [4-[(2Z)-2-[(E)-1-aminoprop-1-enyl]penta-2,4-dienyl]morpholin-3-yl]methanol |
| SMILES | C=C/C=C(CN1CCOCC1CO)\C(N)=C/C |
| InChI | InChI=1S/C13H22N2O2/c1-3-5-11(13(14)4-2)8-15-6-7-17-10-12(15)9-16/h3-5,12,16H,1,6-10,14H2,2H3/b11-5-,13-4+ |
| InChIKey | GWVOGUOENNCNJH-XVJKMRDASA-N |
| XLogP | 0.65 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|