C14H16CsNO7S — CID 144552936
cesium;(2-carboxyphenoxy)methanethioate;ethyl 2-acetamidoacetate (PubChem CID 144552936) has the molecular formula C14H16CsNO7S and a molecular weight of 475.25 g/mol. Its IUPAC name is cesium;(2-carboxyphenoxy)methanethioate;ethyl 2-acetamidoacetate.
| Compound Name | cesium;(2-carboxyphenoxy)methanethioate;ethyl 2-acetamidoacetate |
|---|---|
| PubChem CID | 144552936 |
| Molecular Formula | C14H16CsNO7S |
| Molecular Weight | 475.25 g/mol |
| Exact Mass | 474.97 |
| IUPAC Name | cesium;(2-carboxyphenoxy)methanethioate;ethyl 2-acetamidoacetate |
| SMILES | CCOC(=O)CNC(C)=O.O=C([S-])Oc1ccccc1C(=O)O.[Cs+] |
| InChI | InChI=1S/C8H6O4S.C6H11NO3.Cs/c9-7(10)5-3-1-2-4-6(5)12-8(11)13;1-3-10-6(9)4-7-5(2)8;/h1-4H,(H,9,10)(H,11,13);3-4H2,1-2H3,(H,7,8);/q;;+1/p-1 |
| InChIKey | JLSGLPVYZLNOPD-UHFFFAOYSA-M |
| XLogP | -1.88 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.25 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|