C25H31NO7S — CID 144553122
(Z)-but-2-ene;ethyl 2-acetamidoacetate;(2-methylsulfanylcarbonylphenyl) 2-hydroxybenzoate (PubChem CID 144553122) has the molecular formula C25H31NO7S and a molecular weight of 489.59 g/mol. Its IUPAC name is (Z)-but-2-ene;ethyl 2-acetamidoacetate;(2-methylsulfanylcarbonylphenyl) 2-hydroxybenzoate.
| Compound Name | (Z)-but-2-ene;ethyl 2-acetamidoacetate;(2-methylsulfanylcarbonylphenyl) 2-hydroxybenzoate |
|---|---|
| PubChem CID | 144553122 |
| Molecular Formula | C25H31NO7S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | (Z)-but-2-ene;ethyl 2-acetamidoacetate;(2-methylsulfanylcarbonylphenyl) 2-hydroxybenzoate |
| SMILES | C/C=C\C.CCOC(=O)CNC(C)=O.CSC(=O)c1ccccc1OC(=O)c1ccccc1O |
| InChI | InChI=1S/C15H12O4S.C6H11NO3.C4H8/c1-20-15(18)11-7-3-5-9-13(11)19-14(17)10-6-2-4-8-12(10)16;1-3-10-6(9)4-7-5(2)8;1-3-4-2/h2-9,16H,1H3;3-4H2,1-2H3,(H,7,8);3-4H,1-2H3/b;;4-3- |
| InChIKey | XAAPKTBEWHQNHG-PWIAZYAQSA-N |
| XLogP | 4.38 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|