C15H19N3O3 — CID 144553239
5-ethyl-5-[(2-phenylethylamino)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 144553239) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 5-ethyl-5-[(2-phenylethylamino)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-ethyl-5-[(2-phenylethylamino)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 144553239 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 5-ethyl-5-[(2-phenylethylamino)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(CNCCc2ccccc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C15H19N3O3/c1-2-15(12(19)17-14(21)18-13(15)20)10-16-9-8-11-6-4-3-5-7-11/h3-7,16H,2,8-10H2,1H3,(H2,17,18,19,20,21) |
| InChIKey | UWMCKFCZFPGUAC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|