C14H16N2NaO2S — CID 131882586
CID 131882586 (PubChem CID 131882586) has the molecular formula C14H16N2NaO2S and a molecular weight of 299.35 g/mol.
| Compound Name | CID 131882586 |
|---|---|
| PubChem CID | 131882586 |
| Molecular Formula | C14H16N2NaO2S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | — |
| SMILES | CCC1(CCc2ccccc2)C(=O)NC(=S)NC1=O.[Na] |
| InChI | InChI=1S/C14H16N2O2S.Na/c1-2-14(9-8-10-6-4-3-5-7-10)11(17)15-13(19)16-12(14)18;/h3-7H,2,8-9H2,1H3,(H2,15,16,17,18,19); |
| InChIKey | URANGCXQNBRCFE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|