C15H17N2NaO3 — CID 102240122
sodium 2,6-dioxo-5-(2-phenylethyl)-5-propylpyrimidin-4-olate (PubChem CID 102240122) has the molecular formula C15H17N2NaO3 and a molecular weight of 296.30 g/mol. Its IUPAC name is sodium 2,6-dioxo-5-(2-phenylethyl)-5-propylpyrimidin-4-olate.
| Compound Name | sodium 2,6-dioxo-5-(2-phenylethyl)-5-propylpyrimidin-4-olate |
|---|---|
| PubChem CID | 102240122 |
| Molecular Formula | C15H17N2NaO3 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | sodium 2,6-dioxo-5-(2-phenylethyl)-5-propylpyrimidin-4-olate |
| SMILES | CCCC1(CCc2ccccc2)C(=O)NC(=O)N=C1[O-].[Na+] |
| InChI | InChI=1S/C15H18N2O3.Na/c1-2-9-15(10-8-11-6-4-3-5-7-11)12(18)16-14(20)17-13(15)19;/h3-7H,2,8-10H2,1H3,(H2,16,17,18,19,20);/q;+1/p-1 |
| InChIKey | PBFXPHYWJILJBS-UHFFFAOYSA-M |
| XLogP | -1.58 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |