C18H23N2NaO3 — CID 23703944
sodium 5-ethyl-4,6-dioxo-5-(6-phenylhexyl)-1H-pyrimidin-2-olate (PubChem CID 23703944) has the molecular formula C18H23N2NaO3 and a molecular weight of 338.38 g/mol. Its IUPAC name is sodium 5-ethyl-4,6-dioxo-5-(6-phenylhexyl)-1H-pyrimidin-2-olate.
| Compound Name | sodium 5-ethyl-4,6-dioxo-5-(6-phenylhexyl)-1H-pyrimidin-2-olate |
|---|---|
| PubChem CID | 23703944 |
| Molecular Formula | C18H23N2NaO3 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | sodium 5-ethyl-4,6-dioxo-5-(6-phenylhexyl)-1H-pyrimidin-2-olate |
| SMILES | CCC1(CCCCCCc2ccccc2)C(=O)N=C([O-])NC1=O.[Na+] |
| InChI | InChI=1S/C18H24N2O3.Na/c1-2-18(15(21)19-17(23)20-16(18)22)13-9-4-3-6-10-14-11-7-5-8-12-14;/h5,7-8,11-12H,2-4,6,9-10,13H2,1H3,(H2,19,20,21,22,23);/q;+1/p-1 |
| InChIKey | NPIHTACZDGSOEH-UHFFFAOYSA-M |
| XLogP | -1.05 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|