C10H16N2OS2 — CID 71675967
5,5-dipropyl-2,6-bis(sulfanylidene)-1,3-diazinan-4-one (PubChem CID 71675967) has the molecular formula C10H16N2OS2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 5,5-dipropyl-2,6-bis(sulfanylidene)-1,3-diazinan-4-one.
| Compound Name | 5,5-dipropyl-2,6-bis(sulfanylidene)-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 71675967 |
| Molecular Formula | C10H16N2OS2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 5,5-dipropyl-2,6-bis(sulfanylidene)-1,3-diazinan-4-one |
| SMILES | CCCC1(CCC)C(=O)NC(=S)NC1=S |
| InChI | InChI=1S/C10H16N2OS2/c1-3-5-10(6-4-2)7(13)11-9(15)12-8(10)14/h3-6H2,1-2H3,(H2,11,12,13,14,15) |
| InChIKey | JEHQSGHHQIZUCW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|