C9H16N2OS — CID 82997958
5,5-dipropyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 82997958) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 5,5-dipropyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5,5-dipropyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 82997958 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 5,5-dipropyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCCC1(CCC)NC(=S)NC1=O |
| InChI | InChI=1S/C9H16N2OS/c1-3-5-9(6-4-2)7(12)10-8(13)11-9/h3-6H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | OLMBRQXMZUAADN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|