C7H12N2OS — CID 139085548
(5S)-5-methyl-5-propan-2-yl-2-sulfanylideneimidazolidin-4-one (PubChem CID 139085548) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is (5S)-5-methyl-5-propan-2-yl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5S)-5-methyl-5-propan-2-yl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 139085548 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (5S)-5-methyl-5-propan-2-yl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CC(C)[C@]1(C)NC(=S)NC1=O |
| InChI | InChI=1S/C7H12N2OS/c1-4(2)7(3)5(10)8-6(11)9-7/h4H,1-3H3,(H2,8,9,10,11)/t7-/m0/s1 |
| InChIKey | FMIPFQXZZDKVTG-ZETCQYMHSA-N |
| XLogP | 0.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|