C13H16N3O3- — CID 163144138
[6-[(4S)-4-methyl-5-oxo-4-propan-2-ylimidazolidin-2-ylidene]cyclohexa-2,4-dien-1-ylidene]-dioxidoazanium (PubChem CID 163144138) has the molecular formula C13H16N3O3- and a molecular weight of 262.29 g/mol. Its IUPAC name is [6-[(4S)-4-methyl-5-oxo-4-propan-2-ylimidazolidin-2-ylidene]cyclohexa-2,4-dien-1-ylidene]-dioxidoazanium.
| Compound Name | [6-[(4S)-4-methyl-5-oxo-4-propan-2-ylimidazolidin-2-ylidene]cyclohexa-2,4-dien-1-ylidene]-dioxidoazanium |
|---|---|
| PubChem CID | 163144138 |
| Molecular Formula | C13H16N3O3- |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | [6-[(4S)-4-methyl-5-oxo-4-propan-2-ylimidazolidin-2-ylidene]cyclohexa-2,4-dien-1-ylidene]-dioxidoazanium |
| SMILES | CC(C)[C@]1(C)NC(=C2C=CC=CC2=[N+]([O-])[O-])NC1=O |
| InChI | InChI=1S/C13H16N3O3/c1-8(2)13(3)12(17)14-11(15-13)9-6-4-5-7-10(9)16(18)19/h4-8,15H,1-3H3,(H-,14,17,18,19)/q-1/t13-/m0/s1 |
| InChIKey | FXOHXUOQZCTNMP-ZDUSSCGKSA-N |
| XLogP | 0.91 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|