C8H12N2OS — CID 130933847
2,2-dimethyl-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one (PubChem CID 130933847) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is 2,2-dimethyl-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one.
| Compound Name | 2,2-dimethyl-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one |
|---|---|
| PubChem CID | 130933847 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2,2-dimethyl-6-sulfanylidene-5,7-diazaspiro[3.4]octan-8-one |
| SMILES | CC1(C)CC2(C1)NC(=S)NC2=O |
| InChI | InChI=1S/C8H12N2OS/c1-7(2)3-8(4-7)5(11)9-6(12)10-8/h3-4H2,1-2H3,(H2,9,10,11,12) |
| InChIKey | DSSRHENXPJINAU-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|