C8H12N2O2S — CID 131166057
9,9-dimethyl-2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one (PubChem CID 131166057) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 9,9-dimethyl-2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one.
| Compound Name | 9,9-dimethyl-2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one |
|---|---|
| PubChem CID | 131166057 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 9,9-dimethyl-2-sulfanylidene-7-oxa-1,3-diazaspiro[4.4]nonan-4-one |
| SMILES | CC1(C)COCC12NC(=S)NC2=O |
| InChI | InChI=1S/C8H12N2O2S/c1-7(2)3-12-4-8(7)5(11)9-6(13)10-8/h3-4H2,1-2H3,(H2,9,10,11,13) |
| InChIKey | OBRANTOMMBTDQD-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|