C14H24BNO4 — CID 174027814
CID 174027814 (PubChem CID 174027814) has the molecular formula C14H24BNO4 and a molecular weight of 281.16 g/mol.
| Compound Name | CID 174027814 |
|---|---|
| PubChem CID | 174027814 |
| Molecular Formula | C14H24BNO4 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | — |
| SMILES | [B]C1(C)C(C)(C)CC(C)(C)C(O)(O)C(=O)NC12COC2 |
| InChI | InChI=1S/C14H24BNO4/c1-10(2)6-11(3,4)14(18,19)9(17)16-13(7-20-8-13)12(10,5)15/h18-19H,6-8H2,1-5H3,(H,16,17) |
| InChIKey | PCDIGEZWDIUXHV-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|