C13H23N3O — CID 136998359
7,7,9,9-tetramethyl-2-methylimino-1,3-diazaspiro[4.5]decan-4-one (PubChem CID 136998359) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 7,7,9,9-tetramethyl-2-methylimino-1,3-diazaspiro[4.5]decan-4-one.
| Compound Name | 7,7,9,9-tetramethyl-2-methylimino-1,3-diazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 136998359 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 7,7,9,9-tetramethyl-2-methylimino-1,3-diazaspiro[4.5]decan-4-one |
| SMILES | C/N=C1\NC(=O)C2(CC(C)(C)CC(C)(C)C2)N1 |
| InChI | InChI=1S/C13H23N3O/c1-11(2)6-12(3,4)8-13(7-11)9(17)15-10(14-5)16-13/h6-8H2,1-5H3,(H2,14,15,16,17) |
| InChIKey | QQBOSTCTSOYRNW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|