C7H12N2O — CID 135830855
3,3-dimethyl-5-methyliminopyrrolidin-2-one (PubChem CID 135830855) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 3,3-dimethyl-5-methyliminopyrrolidin-2-one.
| Compound Name | 3,3-dimethyl-5-methyliminopyrrolidin-2-one |
|---|---|
| PubChem CID | 135830855 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 3,3-dimethyl-5-methyliminopyrrolidin-2-one |
| SMILES | C/N=C1\CC(C)(C)C(=O)N1 |
| InChI | InChI=1S/C7H12N2O/c1-7(2)4-5(8-3)9-6(7)10/h4H2,1-3H3,(H,8,9,10) |
| InChIKey | LLQZVHOGRCGQCL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|