C5H7NO2S — CID 159261890
3-methyl-3-sulfanylpyrrolidine-2,5-dione (PubChem CID 159261890) has the molecular formula C5H7NO2S and a molecular weight of 145.18 g/mol. Its IUPAC name is 3-methyl-3-sulfanylpyrrolidine-2,5-dione.
| Compound Name | 3-methyl-3-sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 159261890 |
| Molecular Formula | C5H7NO2S |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | 3-methyl-3-sulfanylpyrrolidine-2,5-dione |
| SMILES | CC1(S)CC(=O)NC1=O |
| InChI | InChI=1S/C5H7NO2S/c1-5(9)2-3(7)6-4(5)8/h9H,2H2,1H3,(H,6,7,8) |
| InChIKey | KWPPUFXCUSQFLC-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|