C12H17NO2 — CID 70395291
3,3-bis(2-methylprop-1-enyl)pyrrolidine-2,5-dione (PubChem CID 70395291) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3,3-bis(2-methylprop-1-enyl)pyrrolidine-2,5-dione.
| Compound Name | 3,3-bis(2-methylprop-1-enyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 70395291 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 3,3-bis(2-methylprop-1-enyl)pyrrolidine-2,5-dione |
| SMILES | CC(C)=CC1(C=C(C)C)CC(=O)NC1=O |
| InChI | InChI=1S/C12H17NO2/c1-8(2)5-12(6-9(3)4)7-10(14)13-11(12)15/h5-6H,7H2,1-4H3,(H,13,14,15) |
| InChIKey | QPIMVMZBEFQDJW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|