C10H10N2O2 — CID 43155363
3-methyl-3-pyridin-2-ylpyrrolidine-2,5-dione (PubChem CID 43155363) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-methyl-3-pyridin-2-ylpyrrolidine-2,5-dione.
| Compound Name | 3-methyl-3-pyridin-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43155363 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3-methyl-3-pyridin-2-ylpyrrolidine-2,5-dione |
| SMILES | CC1(c2ccccn2)CC(=O)NC1=O |
| InChI | InChI=1S/C10H10N2O2/c1-10(6-8(13)12-9(10)14)7-4-2-3-5-11-7/h2-5H,6H2,1H3,(H,12,13,14) |
| InChIKey | NWRCKCYRONJSNQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|