C11H13NO3 — CID 43155390
3-(2,5-dimethylfuran-3-yl)-3-methylpyrrolidine-2,5-dione (PubChem CID 43155390) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-(2,5-dimethylfuran-3-yl)-3-methylpyrrolidine-2,5-dione.
| Compound Name | 3-(2,5-dimethylfuran-3-yl)-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43155390 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 3-(2,5-dimethylfuran-3-yl)-3-methylpyrrolidine-2,5-dione |
| SMILES | Cc1cc(C2(C)CC(=O)NC2=O)c(C)o1 |
| InChI | InChI=1S/C11H13NO3/c1-6-4-8(7(2)15-6)11(3)5-9(13)12-10(11)14/h4H,5H2,1-3H3,(H,12,13,14) |
| InChIKey | QMGXNMDRJKQWBC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|