About (Z)-prop-1-en-1-amine;3-[8-(4-pyridin-3-ylphenyl)pyren-1-yl]pyridine
(Z)-prop-1-en-1-amine;3-[8-(4-pyridin-3-ylphenyl)pyren-1-yl]pyridine (PubChem CID 144553772) has the molecular formula C35H27N3
and a molecular weight of 489.62 g/mol. Its IUPAC name is (Z)-prop-1-en-1-amine;3-[8-(4-pyridin-3-ylphenyl)pyren-1-yl]pyridine.
Molecular Properties
| Compound Name | (Z)-prop-1-en-1-amine;3-[8-(4-pyridin-3-ylphenyl)pyren-1-yl]pyridine |
| PubChem CID | 144553772 |
| Molecular Formula | C35H27N3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | (Z)-prop-1-en-1-amine;3-[8-(4-pyridin-3-ylphenyl)pyren-1-yl]pyridine |
| SMILES | C/C=C\N.c1cncc(-c2ccc(-c3ccc4ccc5ccc(-c6cccnc6)c6ccc3c4c56)cc2)c1 |
| InChI | InChI=1S/C32H20N2.C3H7N/c1-3-25(19-33-17-1)21-5-7-22(8-6-21)27-13-11-23-9-10-24-12-14-28(26-4-2-18-34-20-26)30-16-15-29(27)31(23)32(24)30;1-2-3-4/h1-20H;2-3H,4H2,1H3/b;3-2- |
| InChIKey | JGUNXKFWQDWREI-AHNKWOMYSA-N |
| XLogP | 8.85 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (Z)-prop-1-en-1-amine;3-[8-(4-pyridin-3-ylphenyl)pyren-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-prop-1-en-1-amine;3-[8-(4-pyridin-3-ylphenyl)pyren-1-yl]pyridine?
The IUPAC name of (Z)-prop-1-en-1-amine;3-[8-(4-pyridin-3-ylphenyl)pyren-1-yl]pyridine (CID 144553772) is (Z)-prop-1-en-1-amine;3-[8-(4-pyridin-3-ylphenyl)pyren-1-yl]pyridine.
What is the SMILES notation for (Z)-prop-1-en-1-amine;3-[8-(4-pyridin-3-ylphenyl)pyren-1-yl]pyridine?
The canonical SMILES for (Z)-prop-1-en-1-amine;3-[8-(4-pyridin-3-ylphenyl)pyren-1-yl]pyridine is C/C=C\N.c1cncc(-c2ccc(-c3ccc4ccc5ccc(-c6cccnc6)c6ccc3c4c56)cc2)c1.
What is the InChIKey of (Z)-prop-1-en-1-amine;3-[8-(4-pyridin-3-ylphenyl)pyren-1-yl]pyridine?
The InChIKey is JGUNXKFWQDWREI-AHNKWOMYSA-N. The full InChI is InChI=1S/C32H20N2.C3H7N/c1-3-25(19-33-17-1)21-5-7-22(8-6-21)27-13-11-23-9-10-24-12-14-28(26-4-2-18-34-20-26)30-16-15-29(27)31(23)32(24)30;1-2-3-4/h1-20H;2-3H,4H2,1H3/b;3-2-.
What are the key properties of (Z)-prop-1-en-1-amine;3-[8-(4-pyridin-3-ylphenyl)pyren-1-yl]pyridine?
(Z)-prop-1-en-1-amine;3-[8-(4-pyridin-3-ylphenyl)pyren-1-yl]pyridine has a molecular weight of 489.62 g/mol, XLogP of 8.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-prop-1-en-1-amine;3-[8-(4-pyridin-3-ylphenyl)pyren-1-yl]pyridine is sourced from PubChem (CID 144553772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).