C41H39N3 — CID 144553838
(Z)-hex-3-ene;N-methylethanimine;2-[4-(8-pyridin-3-ylpyren-1-yl)phenyl]pyridine (PubChem CID 144553838) has the molecular formula C41H39N3 and a molecular weight of 573.78 g/mol. Its IUPAC name is (Z)-hex-3-ene;N-methylethanimine;2-[4-(8-pyridin-3-ylpyren-1-yl)phenyl]pyridine.
| Compound Name | (Z)-hex-3-ene;N-methylethanimine;2-[4-(8-pyridin-3-ylpyren-1-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 144553838 |
| Molecular Formula | C41H39N3 |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | (Z)-hex-3-ene;N-methylethanimine;2-[4-(8-pyridin-3-ylpyren-1-yl)phenyl]pyridine |
| SMILES | C/C=N/C.CC/C=C\CC.c1ccc(-c2ccc(-c3ccc4ccc5ccc(-c6cccnc6)c6ccc3c4c56)cc2)nc1 |
| InChI | InChI=1S/C32H20N2.C6H12.C3H7N/c1-2-19-34-30(5-1)22-8-6-21(7-9-22)26-14-12-23-10-11-24-13-15-27(25-4-3-18-33-20-25)29-17-16-28(26)31(23)32(24)29;1-3-5-6-4-2;1-3-4-2/h1-20H;5-6H,3-4H2,1-2H3;3H,1-2H3/b;6-5-;4-3+ |
| InChIKey | YRWAONJZLIATJE-WQDOZMNCSA-N |
| XLogP | 11.44 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|