C43H30N10 — CID 142369902
(E)-2-[4-[6-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)pyren-1-yl]-6-pyridin-3-yl-1,3,5-triazin-2-yl]-N-ethylbut-2-en-1-imine (PubChem CID 142369902) has the molecular formula C43H30N10 and a molecular weight of 686.78 g/mol. Its IUPAC name is (E)-2-[4-[6-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)pyren-1-yl]-6-pyridin-3-yl-1,3,5-triazin-2-yl]-N-ethylbut-2-en-1-imine.
| Compound Name | (E)-2-[4-[6-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)pyren-1-yl]-6-pyridin-3-yl-1,3,5-triazin-2-yl]-N-ethylbut-2-en-1-imine |
|---|---|
| PubChem CID | 142369902 |
| Molecular Formula | C43H30N10 |
| Molecular Weight | 686.78 g/mol |
| Exact Mass | 686.27 |
| IUPAC Name | (E)-2-[4-[6-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)pyren-1-yl]-6-pyridin-3-yl-1,3,5-triazin-2-yl]-N-ethylbut-2-en-1-imine |
| SMILES | C/C=C(\C=N\CC)c1nc(-c2cccnc2)nc(-c2ccc3ccc4c(-c5nc(-c6cccnc6)nc(-c6cccnc6)n5)ccc5ccc2c3c54)n1 |
| InChI | InChI=1S/C43H30N10/c1-3-26(22-44-4-2)38-48-39(29-8-5-19-45-23-29)51-42(50-38)34-17-13-27-12-16-33-35(18-14-28-11-15-32(34)36(27)37(28)33)43-52-40(30-9-6-20-46-24-30)49-41(53-43)31-10-7-21-47-25-31/h3,5-25H,4H2,1-2H3/b26-3+,44-22+ |
| InChIKey | QRCIDVCCDLNFGH-IVKOMDDTSA-N |
| XLogP | 8.97 |
| TPSA | 128.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.78 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|