C37H32N4 — CID 144553966
(Z)-but-2-ene;ethanimine;5-[8-(4-pyridin-2-ylphenyl)pyren-1-yl]pyrimidine (PubChem CID 144553966) has the molecular formula C37H32N4 and a molecular weight of 532.69 g/mol. Its IUPAC name is (Z)-but-2-ene;ethanimine;5-[8-(4-pyridin-2-ylphenyl)pyren-1-yl]pyrimidine.
| Compound Name | (Z)-but-2-ene;ethanimine;5-[8-(4-pyridin-2-ylphenyl)pyren-1-yl]pyrimidine |
|---|---|
| PubChem CID | 144553966 |
| Molecular Formula | C37H32N4 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | (Z)-but-2-ene;ethanimine;5-[8-(4-pyridin-2-ylphenyl)pyren-1-yl]pyrimidine |
| SMILES | C/C=C\C.[H]/N=C/C.c1ccc(-c2ccc(-c3ccc4ccc5ccc(-c6cncnc6)c6ccc3c4c56)cc2)nc1 |
| InChI | InChI=1S/C31H19N3.C4H8.C2H5N/c1-2-16-34-29(3-1)21-6-4-20(5-7-21)25-12-10-22-8-9-23-11-13-26(24-17-32-19-33-18-24)28-15-14-27(25)30(22)31(23)28;1-3-4-2;1-2-3/h1-19H;3-4H,1-2H3;2-3H,1H3/b;4-3-;3-2+ |
| InChIKey | HXRGCWOJRYRHMA-XMRARWRPSA-N |
| XLogP | 10.01 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|