C7H9N3O3 — CID 144556016
2-(hydroxymethyl)-N-methyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 144556016) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is 2-(hydroxymethyl)-N-methyl-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-(hydroxymethyl)-N-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 144556016 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 2-(hydroxymethyl)-N-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | CNC(=O)c1cnc(CO)[nH]c1=O |
| InChI | InChI=1S/C7H9N3O3/c1-8-6(12)4-2-9-5(3-11)10-7(4)13/h2,11H,3H2,1H3,(H,8,12)(H,9,10,13) |
| InChIKey | HPYVYJQBYVVQMI-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |